|
|
| | 4'-Chlorodiazepam Basic information |
| Product Name: | 4'-Chlorodiazepam | | Synonyms: | 7-Chloro-1,3-dihydro-1-methyl-5-(4-chlorophenyl)-2H-1,4-benzodiazepin-2-one;2H-1,4-Benzodiazepin-2-one, 7-chloro-5-(4-chlorophenyl)-1,3-dihydro-1-methyl-;Aids080743;Aids-080743;7-chloro-1,3-dihydro-1-methyl-5-(p-chlorophenyl)-2h-1,4-benzodiazepin-2-one;7-chloro-5-(4-chlorophenyl)-1,3-dihydro-1-methyl-2h-4-benzodiazepin-2-one;7-chloro-5-(p-chlorophenyl)-1,3-dihydro-1-methyl-2h-4-benzodiazepin-2-one;7-CHLORO-5-(4-CHLOROPHENYL)-1,3-DIHYDRO-1-METHYL-2H-1,4-BENZODIAZEPIN-2-ONE | | CAS: | 14439-61-3 | | MF: | C16H12Cl2N2O | | MW: | 319.19 | | EINECS: | | | Product Categories: | | | Mol File: | 14439-61-3.mol |  |
| | 4'-Chlorodiazepam Chemical Properties |
| Melting point | 160-163 °C | | Boiling point | 517.1±50.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | +2C to +8C | | solubility | ethanol: 17 mg/mL | | form | Off-white powder | | pka | 3.08±0.10(Predicted) | | color | White to light yellow | | Water Solubility | 2-hydroxypropyl-β-cyclodextrin: insoluble H2O: insoluble | | BRN | 685202 | | InChI | 1S/C16H12Cl2N2O/c1-20-14-7-6-12(18)8-13(14)16(19-9-15(20)21)10-2-4-11(17)5-3-10/h2-8H,9H2,1H3 | | InChIKey | PUMYFTJOWAJIKF-UHFFFAOYSA-N | | SMILES | O=C1CN=C(C2=CC=C(Cl)C=C2)C3=CC(Cl)=CC=C3N1C |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 22-24/25 | | RIDADR | 2811 | | WGK Germany | 3 | | RTECS | DF0500000 | | F | 10 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral | | Hazardous Substances Data | 14439-61-3(Hazardous Substances Data) |
| | 4'-Chlorodiazepam Usage And Synthesis |
| Uses | 4′-Chlorodiazepam has been used as a translocator protein ligand in mitochondrial functional studies. It has also been used to investigate its protective effects on glucose deprived T98G astrocyte cell lines. | | Biochem/physiol Actions | 4′-Chlorodiazepam (Ro5-4864) is a potent selective ligand for the mitochondrial translocator protein 18kDa (TSPO), formerly known as the peripheral benzodiazepine receptor (PBR). Ro5-4864 does not bind to GABA(A) receptors and lacks typical benzodiazepine effects, but has been found to be neuroprotective in several studies. |
| | 4'-Chlorodiazepam Preparation Products And Raw materials |
|