| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Chloro-N,N-dimethylaniline Basic information |
| Product Name: | 4-Chloro-N,N-dimethylaniline | | Synonyms: | N-(4-Chlorophenyl)dimethylamine;p-Chlorophenyldimethylamine;p-N,N-Dimethylaminochlorobenzene;4-(Dimethylamino)chlorobenzene;BenzenaMine, 4-chloro-N,N-diMethyl-;4-Chloro-N,N-dimethylbenzenamine;4-Chloro-N,N-dimethylbenzenamine (ACI) | | CAS: | 698-69-1 | | MF: | C8H10ClN | | MW: | 155.62 | | EINECS: | | | Product Categories: | | | Mol File: | 698-69-1.mol |  |
| | 4-Chloro-N,N-dimethylaniline Chemical Properties |
| Melting point | 35.5°C | | Boiling point | 256.04°C (rough estimate) | | density | 1.0480 | | refractive index | 1.5578 (estimate) | | storage temp. | 2-8°C(protect from light) | | form | fused solid | | pka | 4.34±0.12(Predicted) | | color | Pale amber/lime | | InChI | InChI=1S/C8H10ClN/c1-10(2)8-5-3-7(9)4-6-8/h3-6H,1-2H3 | | InChIKey | IONGEXNDPXANJD-UHFFFAOYSA-N | | SMILES | C1(N(C)C)=CC=C(Cl)C=C1 |
| | 4-Chloro-N,N-dimethylaniline Usage And Synthesis |
| Purification Methods | Purify it by vacuum sublimation [Guarr et al. J Am Chem Soc 107 5104 1985]. The picrate has m 126-128o (from methanol). |
| | 4-Chloro-N,N-dimethylaniline Preparation Products And Raw materials |
|