- 5,8-Dihydronaphthol
-
- $1.00 / 1KG
-
2019-07-14
- CAS:27673-48-9
- Min. Order: 1KG
- Purity: 90%-99.9%
- Supply Ability: 500kg
- 5,8-Dihydronaphthol
-
- $1.00 / 1KG
-
2019-07-10
- CAS:27673-48-9
- Min. Order: 1KG
- Purity: 90%-99.9%
- Supply Ability: 500kg
|
| | 5,8-Dihydronaphthol Basic information |
| Product Name: | 5,8-Dihydronaphthol | | Synonyms: | 5,8-DIHYDRO-NAPHTHALEN-1-OL;5,8-DIHYDRO-1-NAPHTHOL;5,8-Dihydronaphtol;5,8-Dihydro-1-Naphthol, 85%, Remainder 5,6,7,8-Tetrahydronaphthol;5,8-Di Hydro Naphthol;5,8-DIHYDRO NAPTHOL;1-Naphthalenol, 5,8-dihydro-;5,8-Dihydro-1-naphthalenol | | CAS: | 27673-48-9 | | MF: | C10H10O | | MW: | 146.19 | | EINECS: | 248-596-3 | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals;Aromatics | | Mol File: | 27673-48-9.mol |  |
| | 5,8-Dihydronaphthol Chemical Properties |
| Melting point | 56-60°C | | Boiling point | 120 °C(Press: 1 Torr) | | density | 1.142±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | soluble in Chloroform, DMSO, Methanol | | form | Solid | | pka | 10.18±0.20(Predicted) | | color | Dark Brown | | InChI | InChI=1S/C10H10O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-3,5,7,11H,4,6H2 | | InChIKey | OAHLLHJOPUWLKW-UHFFFAOYSA-N | | SMILES | C1(O)=C2C(CC=CC2)=CC=C1 | | CAS DataBase Reference | 27673-48-9(CAS DataBase Reference) |
| Hazard Codes | Xn,N | | Risk Statements | 22-51/53 | | Safety Statements | 61 | | HS Code | 2906290090 |
| | 5,8-Dihydronaphthol Usage And Synthesis |
| Chemical Properties | Dark Brown Solid | | Uses | Nadolol intermediate. |
| | 5,8-Dihydronaphthol Preparation Products And Raw materials |
|