|
|
| | alpha-Naphtholbenzein Basic information |
| Product Name: | alpha-Naphtholbenzein | | Synonyms: | α-Naphtholbenzein;LABOTEST-BB LT00441167;BIS(4-HYDROXY-1-NAPHTHYL)PHENYLMETHANOL;Bis-(4-hydroxy-1-naphtyl)phenylmethanol;4,4'-[ALPHA-HYDROXYBENZYLIDENE]-DI-1-NAPHTHOL;4-hydroxy-alpha-(4-hydroxynaphthyl)-alpha-phenylnaphthalene-1-methanol;1-NAPHTHOLBENZEIN R. G., REAG. PH. EUR., INDICATOR FOR NON-AQUEOUS SYSTEMS;alpha-hydroxy-alpha-(4-hydroxy-1-naphthalenyl)-alpha-phenyl-1-naphthalenemethanol | | CAS: | 6948-88-5 | | MF: | C27H20O3 | | MW: | 392.45 | | EINECS: | 230-116-9 | | Product Categories: | | | Mol File: | 6948-88-5.mol |  |
| | alpha-Naphtholbenzein Chemical Properties |
| Melting point | 230-235 °C(lit.) | | Boiling point | 477.16°C (rough estimate) | | density | 1.1098 (rough estimate) | | refractive index | 1.5460 (estimate) | | storage temp. | Amber Vial, Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 9.14±0.40(Predicted) | | form | Powder | | color | Red-brown | | PH Range | 8.5(YELLOW)-9.8(GREEN) | | InChI | InChI=1S/C27H20O3/c28-25-16-14-23(19-10-4-6-12-21(19)25)27(30,18-8-2-1-3-9-18)24-15-17-26(29)22-13-7-5-11-20(22)24/h1-17,28-30H | | InChIKey | OUYLDJXFDLBCTQ-UHFFFAOYSA-N | | SMILES | C(O)(C1C=CC=CC=1)(C1C=CC(O)=C2C=CC=CC=12)C1C=CC(O)=C2C=CC=CC=12 | | CAS DataBase Reference | 6948-88-5(CAS DataBase Reference) |
| | alpha-Naphtholbenzein Usage And Synthesis |
| Chemical Properties | RED-BROWN POWDER | | Uses | α-Naphtholbenzein can be used as an indicator during non-aqueous titration. | | Purification Methods | -{4-hydroxynaphth-1-yl})-benzyl alcohol] B2319 M 392.5, m 122-125o, ~ 9.3. Crystallise the alcohol from EtOH, aqueous EtOH or glacial acetic acid. pKEst [Beilstein 6 H 1150.B2319] |
| | alpha-Naphtholbenzein Preparation Products And Raw materials |
|