| Company Name: |
nantong honglong Gold |
| Tel: |
13078814179 13078814179 |
| Email: |
2771867773@qq.com |
|
| | 3'-Bromo-4'-methylacetophenone Basic information |
| | 3'-Bromo-4'-methylacetophenone Chemical Properties |
| Melting point | 42-46 °C(lit.) | | Boiling point | 118°C/3mmHg(lit.) | | density | 1.388±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C9H9BrO/c1-6-3-4-8(7(2)11)5-9(6)10/h3-5H,1-2H3 | | InChIKey | PDJLFESXPVLVMR-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(C)C(Br)=C1)C |
| WGK Germany | 3 | | HS Code | 2914390090 | | Storage Class | 11 - Combustible Solids |
| | 3'-Bromo-4'-methylacetophenone Usage And Synthesis |
| Uses | 3''-Bromo-4''-methylacetophenone is used as a starting material in the synthesis of mansonone E which is used to make mansonone E dervivatives. These derivatives are potent inhibitors of topoisomerase II (Topo II) and topoisomerase I (Topo I) and are also potent antitumor agents. 3''-Bromo-4''-methylacetophenone is also used as a reagent in the synthesis of BAF312, Siponimod which has been tested in the treatment of patients suffering from relapsing-remitting multiple sclerosis. |
| | 3'-Bromo-4'-methylacetophenone Preparation Products And Raw materials |
|