|
|
| | 1H,1H,2H,2H-Perfluorooctyltrichlorosilane Basic information |
| Product Name: | 1H,1H,2H,2H-Perfluorooctyltrichlorosilane | | Synonyms: | Silane, trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-;(TRIDECAFLUORO-1,1,2,2-TETRAHYDROOCTYL)TRICHLOROSILANE;(TRIDECAFLUORO-1,1,2,2-TETRAHYDROOCTYL)-1-TRICHLOROSILANE;TRICHLORO(1H,1H,2H,2H-PERCHLOROOCTYL)SILANE;1H,1H,2H,2H-PERFLUOROOCTYLTRICHLOROSILANE;Perfluorooctyltrichlorosilane;Trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane;(Tridecafluoro-1,1,2,2-tetrahydrooctyl)-1-trichlor | | CAS: | 78560-45-9 | | MF: | C8H4Cl3F13Si | | MW: | 481.54 | | EINECS: | 278-947-6 | | Product Categories: | | | Mol File: | 78560-45-9.mol |  |
| | 1H,1H,2H,2H-Perfluorooctyltrichlorosilane Chemical Properties |
| Melting point | -32°C | | Boiling point | 192 °C(lit.) | | density | 1.3 g/mL at 25 °C(lit.) | | vapor pressure | 0.007-30Pa at 25℃ | | refractive index | n20/D 1.352(lit.) | | Fp | 189 °F | | storage temp. | Storage temp. 2-8°C | | solubility | Miscible with tetrahydrofuran, tetrhydropyran, toluene and other organic solvents. | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.3 | | Water Solubility | 580μg/L at 20℃ | | Sensitive | Moisture Sensitive | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | BRN | 6154526 | | Stability: | Stable. Highly flammable. Incompatible with strong oxidizing agents, water, alcohols, bases. | | InChI | 1S/C8H4Cl3F13Si/c9-25(10,11)2-1-3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)24/h1-2H2 | | InChIKey | PISDRBMXQBSCIP-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si](Cl)(Cl)Cl | | LogP | 2.7 at 20℃ | | CAS DataBase Reference | 78560-45-9(CAS DataBase Reference) | | EPA Substance Registry System | Trichloro((perfluorohexyl)ethyl)silane (78560-45-9) |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 2987 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | Hazard Note | Corrosive/Moisture Sensitive | | TSCA | No | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29319090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 1H,1H,2H,2H-Perfluorooctyltrichlorosilane Usage And Synthesis |
| Chemical Properties | colourless liquid | | Uses | 1H,1H,2H,2H-Perfluorooctyltrichlorosilane is used in the silanization of silicon wafer. Self assembled monolayers treated with this, acts as an anti adhesive layer and release of cured poly(dimethyl siloxanes). It is also used to fabricate chemical surface patterns of self assembled monolayers. | | General Description | Trichloro(1H,1H,2H,2H-perfluorooctyl)silane (PFOCTS) is a chlorosilane that forms a self-assembled monolayer (SAM) on a variety of substrates. It is majorly used to modify the surface with superhydrophobic properties. It is a biocompatible polymer with low surface energy. PFOCTS exhibits anti-fouling properties with high wettability which facilitates the release of different composites from the mold. | | Flammability and Explosibility | Not classified | | Synthesis | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctene, starting materials, are charged under an N2 atmosphere to a three-necked glass flask, and CPC 072 (Pt(0)-divinyltetramethyidisiloxane in xylene) is added. Trichlorosilane is added dropwise at room temperature and with stirring over 85 minutes. The immediately ensuing reaction is exothermic, the temperature rising to 115° C. After the purification, 1H,1H,2H,2H-Perfluorooctyltrichlorosilane are obtained (yield: 99%). |
| | 1H,1H,2H,2H-Perfluorooctyltrichlorosilane Preparation Products And Raw materials |
|