| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
Boc-Lys(Me)2-OH manufacturers
- BOC-LYS(ME)2-OH
-
-
2020-01-09
- CAS:65671-53-6
- Min. Order: 1KG
- Purity: 98%;99%
- Supply Ability: 500g; 1kg; 10kg; 25kg
|
| | Boc-Lys(Me)2-OH Basic information |
| Product Name: | Boc-Lys(Me)2-OH | | Synonyms: | N-ALPHA-T-BUTOXYCARBONYL-N-EPSILON,N-EPSILON-DIMETHYL-L-LYSINE;N-ALPHA-T-BOC-N-EPSILON-DIMETHYL-L-LYSINE;N-ALPHA-BOC-(S)-2-AMINO-6-(DIMETHYLAMINO)HEXANOIC ACID;BOC-N-EPSILON-DIMETHYL-L-LYSINE;BOC-LYSINE(ME)2-OH;Boc-N-ε-dimethyl-L-lysine;N-α-butoxycarbonyl-N-ε-L-lysine;Boc-Ne,e-dimethyl-L-lysine | | CAS: | 65671-53-6 | | MF: | C13H26N2O4 | | MW: | 274.36 | | EINECS: | | | Product Categories: | | | Mol File: | 65671-53-6.mol |  |
| | Boc-Lys(Me)2-OH Chemical Properties |
| Boiling point | 413.3±40.0 °C(Predicted) | | density | 1.064±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.92±0.21(Predicted) | | form | powder | | Major Application | peptide synthesis | | InChI | 1S/C13H26N2O4/c1-13(2,3)19-12(18)14-10(11(16)17)8-6-7-9-15(4)5/h10H,6-9H2,1-5H3,(H,14,18)(H,16,17)/t10-/m0/s1 | | InChIKey | KPXRFYHPDPDJSY-JTQLQIEISA-N | | SMILES | [N+H](CCCC[C@H](NC(=O)OC(C)(C)C)C(=O)[O-])(C)C |
| WGK Germany | WGK 2 water endangering | | HS Code | 2924 19 00 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | Boc-Lys(Me)2-OH Usage And Synthesis |
| Uses | Boc-Lys(Me)2-OH is used in the synthesis of peptidyl α-keto thiazoles as tissue factor VIIa inhibitors. It is also used to prepare tetrahydropyranylglycine sulfonamides as bradykinin hB2 receptor antagonists. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-Lys(Me)2-OH Preparation Products And Raw materials |
|