|
|
| | 2,7-Dimethoxynaphthalene Basic information |
| Product Name: | 2,7-Dimethoxynaphthalene | | Synonyms: | 2,7-DIMETHOXYNAPHTHALENE;2,7-DimethoxylNaphthalene;2,7-Dimethoxy;2,7-DIMETHOXYNAPHTHALENE, 99% PHARM GRADE;Naphthalene, 2,7-dimethoxy-;2,7-Dimethoxynaphthalene,98%;2,7- twoMethoxy naphthalene;2,7-Dimethoxynaphthalin | | CAS: | 3469-26-9 | | MF: | C12H12O2 | | MW: | 188.22 | | EINECS: | 222-433-6 | | Product Categories: | API intermediates;Ethers;Organic Building Blocks;Oxygen Compounds;FINE Chemical & INTERMEDIATES;Naphthalene derivatives;bc0001 | | Mol File: | 3469-26-9.mol |  |
| | 2,7-Dimethoxynaphthalene Chemical Properties |
| Melting point | 137-139 °C (lit.) | | Boiling point | 283.23°C (rough estimate) | | density | 1.0750 (rough estimate) | | refractive index | 1.6010 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C12H12O2/c1-13-11-5-3-9-4-6-12(14-2)8-10(9)7-11/h3-8H,1-2H3 | | InChIKey | PPKHAIRFQKFMLE-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC(OC)=C2)=CC=C1OC | | CAS DataBase Reference | 3469-26-9(CAS DataBase Reference) | | NIST Chemistry Reference | Naphthalene, 2,7-dimethoxy-(3469-26-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-24/25 | | WGK Germany | 3 | | HS Code | 29093090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,7-Dimethoxynaphthalene Usage And Synthesis |
| Chemical Properties | off-white to brown crystalline powder | | Uses | 2,7-Dimethoxynaphthalene was employed as matrix to investigate the structure of polymetallic porphyrins via matrix-assisted laser desorption/ionization. It was also used in the synthesis of:
- peri-aroylnaphthalene compounds via elective electrophilic aromatic aroylation
- 2-amino-1,2,3,4-tetrahydronaphthalene-6,7-diol
|
| | 2,7-Dimethoxynaphthalene Preparation Products And Raw materials |
|