| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Bromo-4,5-dimethoxybenzoic acid Basic information |
| Product Name: | 2-Bromo-4,5-dimethoxybenzoic acid | | Synonyms: | 6-BROMOVERATRIC ACID;6-BROMO-3,4-DIMETHOXYBENZOIC ACID;2-Bromo-4,5-dimethoxybenzoic acid,97%;Nsc10074;RARECHEM AL BE 0015;441074_ALDRICH;Benzoic acid, 2-bromo-4,5-dimethoxy-;InChI=1/C9H9BrO4/c1-13-7-3-5(9(11)12)6(10)4-8(7)14-2/h3-4H,1-2H3,(H,11,12 | | CAS: | 6286-46-0 | | MF: | C9H9BrO4 | | MW: | 261.07 | | EINECS: | | | Product Categories: | Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Aromatics Compounds;Aromatics | | Mol File: | 6286-46-0.mol |  |
| | 2-Bromo-4,5-dimethoxybenzoic acid Chemical Properties |
| Melting point | 188-190 °C (lit.) | | Boiling point | 337.6±42.0 °C(Predicted) | | density | 1.571±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 3.00±0.10(Predicted) | | form | Powder | | color | White to cream or yellow | | InChI | 1S/C9H9BrO4/c1-13-7-3-5(9(11)12)6(10)4-8(7)14-2/h3-4H,1-2H3,(H,11,12) | | InChIKey | HWFCHCRFQWEFMU-UHFFFAOYSA-N | | SMILES | COc1cc(Br)c(cc1OC)C(O)=O | | CAS DataBase Reference | 6286-46-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Bromo-4,5-dimethoxybenzoic acid Usage And Synthesis |
| Chemical Properties | Off-White Crystalline Solid | | Uses | 2-Bromo-4,5-dimethoxybenzoic acid may be used as starting material for the synthesis of norathyriol and urolithins. | | General Description | 2-Bromo-4,5-dimethoxybenzoic acid is a 2-halo-4,5-dialkoxybenzoic acid derivative. |
| | 2-Bromo-4,5-dimethoxybenzoic acid Preparation Products And Raw materials |
|