| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | Butyltin tris(2-ethylhexanoate) Basic information |
| | Butyltin tris(2-ethylhexanoate) Chemical Properties |
| Melting point | -33°C | | Boiling point | 544.8±33.0 °C(Predicted) | | density | 1.105 g/mL at 25 °C(lit.) | | vapor pressure | 0.47Pa at 25℃ | | refractive index | n20/D 1.465(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | 34.386g/L in organic solvents at 20 ℃ | | Specific Gravity | 1.105 | | Water Solubility | 152μg/L at 20℃ | | InChI | InChI=1S/3C8H16O2.C4H9.Sn/c3*1-3-5-6-7(4-2)8(9)10;1-3-4-2;/h3*7H,3-6H2,1-2H3,(H,9,10);1,3-4H2,2H3;/q;;;;+3/p-3 | | InChIKey | GVKORIDPEBYOFR-UHFFFAOYSA-K | | SMILES | [Sn](OC(=O)C(CC)CCCC)(OC(=O)C(CC)CCCC)(OC(=O)C(CC)CCCC)CCCC | | LogP | 2.55 at 20℃ | | CAS DataBase Reference | 23850-94-4(CAS DataBase Reference) | | EPA Substance Registry System | Stannane, butyltris[(2-ethyl-1-oxohexyl)oxy]- (23850-94-4) |
| Hazard Codes | T | | Risk Statements | 23/24/25-36/37/38 | | Safety Statements | 26-28-36/37/39-45 | | RIDADR | UN 2788 6.1/PG 3 | | WGK Germany | 3 | | RTECS | WH6788500 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III |
| | Butyltin tris(2-ethylhexanoate) Usage And Synthesis |
| Uses | Esterification catalyst | | Flammability and Explosibility | Not classified |
| | Butyltin tris(2-ethylhexanoate) Preparation Products And Raw materials |
|