2-Bromo-6-nitrobenzothiazole manufacturers
|
| | 2-Bromo-6-nitrobenzothiazole Basic information |
| Product Name: | 2-Bromo-6-nitrobenzothiazole | | Synonyms: | 6-Nitro-2-bromobenzothiazole;2-BROMO-6-NITRO-1,3-BENZOTHIAZOLE;2-bromo-6-nitrobenzo[d]thiazole;2-BROMO-6-NITROBENZOT;2-Bromo-6-nitro-1,3-benzothiazole 95+%;Benzothiazole, 2-bromo-6-nitro-;2-Bromo-6-nitrobenzothiazole | | CAS: | 2516-37-2 | | MF: | C7H3BrN2O2S | | MW: | 259.08 | | EINECS: | | | Product Categories: | | | Mol File: | 2516-37-2.mol |  |
| | 2-Bromo-6-nitrobenzothiazole Chemical Properties |
| Melting point | 206-207 | | Boiling point | 393.1±34.0 °C(Predicted) | | density | 1.929 | | storage temp. | -20°C, stored under nitrogen | | pka | -2.40±0.10(Predicted) | | form | solid | | Appearance | Yellow to brown Solid | | InChI | 1S/C7H3BrN2O2S/c8-7-9-5-2-1-4(10(11)12)3-6(5)13-7/h1-3H | | InChIKey | OEDLGBGVVRSXGG-UHFFFAOYSA-N | | SMILES | BrC1=NC2=CC=C(C=C2S1)[N+]([O-])=O |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 29342000 | | Storage Class | 11 - Combustible Solids |
| | 2-Bromo-6-nitrobenzothiazole Usage And Synthesis |
| | 2-Bromo-6-nitrobenzothiazole Preparation Products And Raw materials |
|