| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-Bromo-3-(pentafluorosulfanyl)benzene Basic information |
| | 1-Bromo-3-(pentafluorosulfanyl)benzene Chemical Properties |
| Boiling point | 82 °C(Press: 12 Torr) | | density | 1.831 g/mL at 25 °C | | refractive index | n20/D 1.480 | | Fp | 88 °C | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow to Red | | InChI | InChI=1S/C6H4BrF5S/c7-5-2-1-3-6(4-5)13(8,9,10,11)12/h1-4H | | InChIKey | QRPMKEUTGAXKSD-UHFFFAOYSA-N | | SMILES | C1(S(F)(F)(F)(F)F)=CC=CC(Br)=C1 |
| Hazard Codes | T,Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Hazard Note | Toxic | | HS Code | 29309090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-Bromo-3-(pentafluorosulfanyl)benzene Usage And Synthesis |
| Chemical Properties | Colorless to yellow liquid | | Uses | 3-Bromophenylsulfur Pentafluoride is a reactant in the preparation of blue-to-green emitting neutral Ir(III) complexes bearing pentafluorosulfanyl groups. | | Synthesis | 1-Bromo-3-(pentafluorosulfanyl)benzene is an organic intermediate that can be prepared from m-(pentafluorothio)nitrobenzene by diazotization. |
| | 1-Bromo-3-(pentafluorosulfanyl)benzene Preparation Products And Raw materials |
|