|
|
| | 3H-Heptafluoro-2,2,4,4-tetrahydroxypentane Basic information |
| Product Name: | 3H-Heptafluoro-2,2,4,4-tetrahydroxypentane | | Synonyms: | 1,1,1,3,5,5,5-Heptafluoro-2,2,4,4-tetrahydroxypentane;1,1,1,3,5,5,5-HEPTAFLUOROACETYLACETONE DIHYDRATE;3H-HEPTAFLUORO-2,2,4,4-TETRAHYDROXYPENTANE, 97% MIN.;1,1,1,3,5,5,5-Heptafluoroacetylacetonedihydrate97%;2,2,4,4-Pentanetetrol, 1,1,1,3,5,5,5-heptafluoro-;1,1,1,3,5,5,5-Heptafluoro-2,2,4,4-pentanetetrol;3H-Heptafluoro-2,2,4,4-tetrahydroxypentane | | CAS: | 77953-71-0 | | MF: | C5H5F7O4 | | MW: | 262.08 | | EINECS: | | | Product Categories: | | | Mol File: | 77953-71-0.mol |  |
| | 3H-Heptafluoro-2,2,4,4-tetrahydroxypentane Chemical Properties |
| Melting point | 113-114°C | | Boiling point | 443.119±40.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.875±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 8.137±0.50(predicted) | | InChIKey | NZCXKNVJJQJKKN-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(O)(O)C(F)C(O)(O)C(F)(F)F | | EPA Substance Registry System | 3H-Perfluoro-2,2,4,4-tetrahydroxypentane (77953-71-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2914310000 | | Storage Class | 11 - Combustible Solids |
| | 3H-Heptafluoro-2,2,4,4-tetrahydroxypentane Usage And Synthesis |
| | 3H-Heptafluoro-2,2,4,4-tetrahydroxypentane Preparation Products And Raw materials |
|