| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:6-(p-Toluidino)-2-naphthalenesulfonyl chloride CAS:62778-24-9 Purity:suitable for fluorescence, ≥98.0% (HPLC) Package:250mg;50mg;250mg;50mg Remarks:NULL
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:6-(p-Toluidino)-2-naphthalenesulfonyl chloride CAS:62778-24-9
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
CAS:62778-24-9
|
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
| Products Intro: |
|
|
| | 6-(P-TOLUIDINO)NAPHTHALENE-2-SULFONYL Basic information |
| Product Name: | 6-(P-TOLUIDINO)NAPHTHALENE-2-SULFONYL | | Synonyms: | 2,6-tns-cl;2,6-TNS-Cl, 6-(4-Methylanilino)naphthalene-2-sulfonylchloride;6-[(4-Methylphenyl)amino]-2-naphthalenesulfonic acid chloride;6-(4-Methylanilino)naphthalene-2-sulfonylchloride;6-[(4-methylphenyl)amino]-2-naphthalenesulfonylchloride;6-(P-TOLUIDINO)NAPHTHALENE-2-SULFONYL;6-[(4-methylphenyl)amino]-2-naphthalenesulfonylchlorid;2-Naphthalenesulfonyl chloride, 6-[(4-methylphenyl)amino]- | | CAS: | 62778-24-9 | | MF: | C17H14ClNO2S | | MW: | 331.82 | | EINECS: | | | Product Categories: | | | Mol File: | 62778-24-9.mol |  |
| | 6-(P-TOLUIDINO)NAPHTHALENE-2-SULFONYL Chemical Properties |
| Boiling point | 526.4±35.0 °C(Predicted) | | density | 1.368±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMF: soluble | | pka | -0.12±0.40(Predicted) | | BRN | 6521872 | | InChI | 1S/C17H14ClNO2S/c1-12-2-6-15(7-3-12)19-16-8-4-14-11-17(22(18,20)21)9-5-13(14)10-16/h2-11,19H,1H3 | | InChIKey | NONZPGMJWHNDKP-UHFFFAOYSA-N | | SMILES | Cc1ccc(Nc2ccc3cc(ccc3c2)S(Cl)(=O)=O)cc1 || Cc1ccc(Nc2ccc3cc(ccc3c2)S(Cl)(=O)=O)cc1 | | EPA Substance Registry System | 2-Naphthalenesulfonyl chloride, 6-[(4-methylphenyl)amino]- (62778-24-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8-10-21 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 6-(P-TOLUIDINO)NAPHTHALENE-2-SULFONYL Usage And Synthesis |
| Uses | 6-(p-Toluidino)-2-naphthalenesulfonyl chloride is a fluorescent, hydrophobic probe utilized for labeling peptides to monitor conformational changes of a molecular assembly by measuring alterations in fluorescence intensity . |
| | 6-(P-TOLUIDINO)NAPHTHALENE-2-SULFONYL Preparation Products And Raw materials |
|