|
|
| | Bisphenol a (2 3-dihydroxypropyl) glycid Basic information |
| Product Name: | Bisphenol a (2 3-dihydroxypropyl) glycid | | Synonyms: | 3-[4-[1-Methyl-1-[4-(oxiranylmethoxy)phenyl]ethyl]phenoxy]-1,2-propanediol;3-[4-[4-(Glycidyloxy)-α,α-dimethylbenzyl]phenoxy]propane-1,2-diol;4-(Glycidyloxy)-4'-(2,3-dihydroxypropoxy)[1,1'-(dimethylmethylene)bisbenzene];Ccris 8664;Einecs 278-357-9;Bisphenol A (2,3-dihydroxypropyl) glycidyl ether,2-[4-(2,3-Dihydroxypropyloxy)phenyl]-2-[4-(glycidyloxy)phenyl]propane, BADGE-H2O;3-[4-[1-[4-(2,3-epoxypropoxy)phenyl]-1-methylethyl]phenoxy]propane-1,2-diol;2-[4-(2,3-dihydroxypropyloxy)phenyl]-2-[4-(glycidyloxy)phenyl]propane | | CAS: | 76002-91-0 | | MF: | C21H26O5 | | MW: | 358.43 | | EINECS: | 278-357-9 | | Product Categories: | | | Mol File: | 76002-91-0.mol |  |
| | Bisphenol a (2 3-dihydroxypropyl) glycid Chemical Properties |
| Boiling point | 553.0±50.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 13.53±0.20(Predicted) | | BRN | 8276468 | | Major Application | cleaning products
cosmetics
food and beverages
personal care | | InChI | InChI=1S/C21H26O5/c1-21(2,15-3-7-18(8-4-15)24-12-17(23)11-22)16-5-9-19(10-6-16)25-13-20-14-26-20/h3-10,17,20,22-23H,11-14H2,1-2H3 | | InChIKey | NBLIPZBCGXIEFO-UHFFFAOYSA-N | | SMILES | C(O)C(O)COC1=CC=C(C(C)(C2=CC=C(OCC3CO3)C=C2)C)C=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/38-43 | | Safety Statements | 28-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Resp. Sens. 1
Skin Irrit. 2 |
| | Bisphenol a (2 3-dihydroxypropyl) glycid Usage And Synthesis |
| Uses | Bisphenol A diglycidyl ether (BADGE) is an epoxide that is used as a starting substance in the manufacturing of can coatings for food-contact applications, pharmaceutial creams and may produce reaction products migration from the coating. | | Definition | ChEBI: 3-(4-(1-(4-(2,3-Epoxypropoxy)phenyl)-1-methylethyl)phenoxy)propane-1,2-diol is a diarylmethane. |
| | Bisphenol a (2 3-dihydroxypropyl) glycid Preparation Products And Raw materials |
|