- Gibberllin A7
-
- $267.00 / 50mg
-
2026-03-10
- CAS:510-75-8
- Min. Order:
- Purity: 99.18%
- Supply Ability: 10g
- gibberellin A7
-
- $1.00 / 1kg
-
2019-07-06
- CAS:510-75-8
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100KG
|
| | Gibberellin A7 Basic information |
| Product Name: | Gibberellin A7 | | Synonyms: | Gibberllin A7;GIBBERELLIN A7 PLANT CELL CULTURE*TESTED;Gibb-3-ene-1,10-dicarboxylic acid, 2,4a-dihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1alpha,2beta,4aalpha,4bbeta,10beta)-;Gibberelliin A7;Ga7:;Gibb-3-ene-1,10-dicarboxylic acid, 2,4a-dihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)-;GIBBERELLINGA7(A7);Gibberellin A7 | | CAS: | 510-75-8 | | MF: | C19H22O5 | | MW: | 330.38 | | EINECS: | 208-117-0 | | Product Categories: | | | Mol File: | 510-75-8.mol |  |
| | Gibberellin A7 Chemical Properties |
| Melting point | 252-255 °C | | Boiling point | 582.0±50.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMSO (Slightly), Ethanol (Slightly, Sonicated), Methanol (Slightly) | | pka | 4.20±0.60(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Light sensitive | | InChIKey | SEEGHKWOBVVBTQ-UYDGZXIYNA-N | | SMILES | C([C@@H]1[C@]23CC(=C)[C@]([H])(CC[C@@]2([H])[C@@]24C=C[C@H](O)[C@](C(=O)O2)(C)[C@@]14[H])C3)(=O)O |&1:1,2,6,10,12,15,17,22,r| | | EPA Substance Registry System | Gibberellin A7 (510-75-8) |
| | Gibberellin A7 Usage And Synthesis |
| Chemical Properties | Melting point of needle-like crystals is 169-172°C, melting point of prismatic crystals is 202°C; slightly soluble in water, easily soluble in 95% ethanol. | | Uses | Gibberellin A7 is an plant hormone that was isolated from culture filtrates of the fungus Gibberella fujikuroi. Gibberellin A7 was shown to promote the growth and elongation of cells. | | Definition | ChEBI: A C19-gibberellin that is a pentacyclic diterpenoid responsible for promoting growth and development in plants. |
| | Gibberellin A7 Preparation Products And Raw materials |
|