|
|
| | β-n-Propylglutaric acid Basic information |
| Product Name: | β-n-Propylglutaric acid | | Synonyms: | 3-n-Propylglutaric acid;3-Propylpentanedioic acid;beta-n-Propylglutaric acid;Pentanedioic acid, 3-propyl-;3-PropylglutaricAci;3-PROPYL GLUTARIC ACID;TIMTEC-BB SBB007755;NISTC4165984 | | CAS: | 4165-98-4 | | MF: | C8H14O4 | | MW: | 174.19 | | EINECS: | 224-016-4 | | Product Categories: | | | Mol File: | 4165-98-4.mol |  |
| | β-n-Propylglutaric acid Chemical Properties |
| Melting point | 52 °C | | Boiling point | 321.0±15.0 °C(Predicted) | | density | 1.159±0.06 g/cm3(Predicted) | | pka | 4.19±0.10(Predicted) | | InChI | InChI=1S/C8H14O4/c1-2-3-6(4-7(9)10)5-8(11)12/h6H,2-5H2,1H3,(H,9,10)(H,11,12) | | InChIKey | YHJZYPZZBZPIPX-UHFFFAOYSA-N | | SMILES | C(O)(=O)CC(CCC)CC(O)=O |
| | β-n-Propylglutaric acid Usage And Synthesis |
| Uses | 3-Propylglutaric Acid, can be used in various chemical synthesis such as Hypocholesterolemic agents. |
| | β-n-Propylglutaric acid Preparation Products And Raw materials |
|