| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Racemetirosine
-
- $29.00
-
2026-05-11
- CAS:658-48-0
- Purity: 98.73%
- Supply Ability: 10g
|
| | α-Methyl-DL-p-tyrosine Basic information |
| Product Name: | α-Methyl-DL-p-tyrosine | | Synonyms: | (2R)-2-ammonio-3-(4-hydroxyphenyl)-2-methylpropanoate;alpha-methyl-para-tyrosine;alpha-methyl-p-tyrosine;alpha-methyl-tyrosin;h9/88;DL-α-Methyltyrosine;2-P-HYDROXYPHENYLMETHYL-DL-ALANINE;Tyrosine, .alpha.-methyl- | | CAS: | 658-48-0 | | MF: | C10H13NO3 | | MW: | 195.22 | | EINECS: | 211-523-0 | | Product Categories: | | | Mol File: | 658-48-0.mol |  |
| | α-Methyl-DL-p-tyrosine Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 331.88°C (rough estimate) | | density | 1.1926 (rough estimate) | | refractive index | 1.5150 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Aqueous Acid (Sparingly), Aqueous Base, Water (Slightly) | | form | Solid | | pka | 2.29±0.16(Predicted) | | color | White to Off-White | | BRN | 2938704 | | Major Application | peptide synthesis | | InChI | InChI=1S/C10H13NO3/c1-10(11,9(13)14)6-7-2-4-8(12)5-3-7/h2-5,12H,6,11H2,1H3,(H,13,14) | | InChIKey | NHTGHBARYWONDQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(C)(CC1C=CC(O)=CC=1)N | | EPA Substance Registry System | .alpha.-Methyltyrosine (658-48-0) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | YP2890000 | | TSCA | TSCA listed | | HS Code | 29225000 | | Storage Class | 11 - Combustible Solids |
| | α-Methyl-DL-p-tyrosine Usage And Synthesis |
| Chemical Properties | off-white fine powder | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis | | in vivo | α-Methyl-p-tyrosine (250 mg/kg, intraperitoneal injection, single dose) can exacerbate the severity and duration of tonic and clonic seizures induced by Pentylenetetrazol in male CFI mice[2]. | Animal Model: | Pentylenetetrazol (PTZ)-induced epilepsy CFI strain mouse model (15-25 g) | | Dosage: | 250 mg/kg | | Administration: | Intraperitoneal injection (i.p.), single dose, PTZ administered 8 hours after α-Methyl-p-tyrosine injection | | Result: | Increased the severity and duration of seizures, especially enhancing tonic and clonic seizures induced by PTZ. |
|
| | α-Methyl-DL-p-tyrosine Preparation Products And Raw materials |
|