| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
PENBUTOLOL SULFATE (200 MG) manufacturers
|
| | PENBUTOLOL SULFATE (200 MG) Basic information |
| Product Name: | PENBUTOLOL SULFATE (200 MG) | | Synonyms: | 2-Propanol, 1-(2-cyclopentylphenoxy)-3-[(1,1-dimethylethyl)amino]-,(2S)-, sulfate (2:1) (salt);(-)-1-(tert-butylamino)-3-(o-cyclopentylphenoxyl)-2-propanolsulfate;(-)-terbuclomine;(s)-1-(2-cyclopentylphenoxy)-3-((1,1-dimethylethyl)amino)-2-propanolsulfate;1-(2-cyclopentylphenoxy)-3-((1,1-dimethylethyl)amino)-2-propano(s)-2-propanosulfa;penbutololsulfate;penbutololsulfato;PENBUTOLOL SULFATE (200 MG) | | CAS: | 38363-32-5 | | MF: | C44H76N2O8S | | MW: | 793.14784 | | EINECS: | 253-906-5 | | Product Categories: | | | Mol File: | 38363-32-5.mol |  |
| | PENBUTOLOL SULFATE (200 MG) Chemical Properties |
| Melting point | 216-218℃ (Decomposition) | | alpha | 20D -24.6° (c = 1 in methanol) | | storage temp. | Store at -20°C,sealed storage, away from moisture | | solubility | Slightly soluble in water, soluble in methanol, practically insoluble in cyclohexane. | | form | Solid | | color | White to off-white | | Stability: | Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChIKey | FEDSNBHHWZEYTP-ZFQYHYQMSA-N | | SMILES | [S](=O)(=O)(O)O.N(C[C@H](O)COc3c(cccc3)C4CCCC4)C(C)(C)C.N(C[C@H](O)COc1c(cccc1)C2CCCC2)C(C)(C)C |
| WGK Germany | WGK 3 | | HS Code | 2922190900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
STOT SE 3 | | Toxicity | mmo-sat 10 mg/plate MUREAV 204,675,88 |
| | PENBUTOLOL SULFATE (200 MG) Usage And Synthesis |
| Chemical Properties | White or almost white, crystalline powder. | | Uses | Anti-adrenergic (β-receptor). | | Uses | (S)-Penbutolol Sulfate is an isomer of Penbutolol (P220500), a β-adrenoceptor antagonist. Antihypertensive. | | Definition | ChEBI: Penbutolol sulfate is an ethanolamine sulfate salt. It has a role as a beta-adrenergic antagonist. It is functionally related to a penbutolol. | | Brand name | Levatol(Schwarz Pharma). | | Safety Profile | Poison by intravenous and intraperitoneal routes. Moderately toxic by ingestion and subcutaneous routes. Mutation data reported. When heated to decomposition it emits toxic fumes of NOx and SOx. |
| | PENBUTOLOL SULFATE (200 MG) Preparation Products And Raw materials |
|