|
|
| | Fipronil-sulfone Basic information |
| Product Name: | Fipronil-sulfone | | Synonyms: | 4-((trifluoromethyl)sulfonyl)-;5-amino-1-(2,6-dichloro-4-(trifluoromethyl)phenyl)-1h-pyrazole-3-carbonitril;6-dichloro-4-trifluoromethylphenyl)-3-cyano-4-trifluoromethanesulfonyl-1-(;m&b46136;5-AMino-1-(2,6-dichloro-4-trifluoroMethylphenyl)-3-cyano-4-trifluoroMethylsulfonylpyrazole;5-AMino-1-[2,6-Dichloro-4-(trifluoroMethyl)phenyl]-4-(trifluoroMethylsulfonyl)pyrazole-3-carbonitrile;1H-Pyrazole-3-carbonitrile, 5-aMino-1-[2,6-dichloro-4-(trifluoroMethyl)phenyl]-4-[(trifluoroMethyl)sulf onyl]-;FIPRONIL SULFONE STANDARD | | CAS: | 120068-36-2 | | MF: | C12H4Cl2F6N4O2S | | MW: | 453.15 | | EINECS: | | | Product Categories: | | | Mol File: | 120068-36-2.mol |  |
| | Fipronil-sulfone Chemical Properties |
| Melting point | 225℃ | | Boiling point | 531.6±50.0 °C(Predicted) | | density | 1.85±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) | | form | Solid | | pka | -8.12±0.20(Predicted) | | color | White to off-white | | BRN | 8729974 | | Major Application | agriculture environmental | | InChI | InChI=1S/C12H4Cl2F6N4O2S/c13-5-1-4(11(15,16)17)2-6(14)8(5)24-10(22)9(7(3-21)23-24)27(25,26)12(18,19)20/h1-2H,22H2 | | InChIKey | LGHZJDKSVUTELU-UHFFFAOYSA-N | | SMILES | N1(C2=C(Cl)C=C(C(F)(F)F)C=C2Cl)C(N)=C(S(C(F)(F)F)(=O)=O)C(C#N)=N1 | | EPA Substance Registry System | Fipronil Sulfone (120068-36-2) |
| Hazard Codes | T,N | | Risk Statements | 25-50 | | Safety Statements | 45-61 | | RIDADR | UN2811 - class 6.1 - PG 3 - EHS - Toxic solids, organic, n.o.s., HI: all | | WGK Germany | 3 | | RTECS | UQ3515375 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| | Fipronil-sulfone Usage And Synthesis |
| Uses | Fipronil Sulfone is a sulfone metabolite of the insecticide Fipronil (F342200). Fipronil Sulfone blocks γ-aminobutyric acid- and glutamate-activated chloride channels in mammalian and insect neurons. | | Definition | ChEBI: A member of the class of pyrazoles that is 1H-pyrazole that is substituted at positions 1, 3, 4, and 5 by 2,6-dichloro-4-(trifluoromethyl)phenyl, cyano, (trifluoromethyl)sulfonyl, and amino groups, respectively. It is a metabolite of the
agrochemical fipronil. |
| | Fipronil-sulfone Preparation Products And Raw materials |
|