| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | S(-)-SCH-23388 nor methyl- HCl Basic information |
| Product Name: | S(-)-SCH-23388 nor methyl- HCl | | Synonyms: | S(-)-SCH-23388 NORMETHYL HYDROCHLORIDE ( S(-)-CHB);nor-s-(-)-sch-23388 hydrochloride;s-(-)-7-chloro-8-hydroxy-1-phenyl-2,3,4,5-tetrahydro-1h-3-benzazepine;1H-3-Benzazepin-7-ol, 8-chloro-2,3,4,5-tetrahydro-5-phenyl-;S(-)-SCH-23388 nor methyl- HCl | | CAS: | 107128-79-0 | | MF: | C16H16ClNO | | MW: | 273.76 | | EINECS: | | | Product Categories: | | | Mol File: | 107128-79-0.mol |  |
| | S(-)-SCH-23388 nor methyl- HCl Chemical Properties |
| Boiling point | 426.637±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.219±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 8.634±0.40(predicted) | | Major Application | forensics and toxicology
pharmaceutical (small molecule)
veterinary | | InChI | 1S/C16H16ClNO.ClH/c17-15-8-12-6-7-18-10-14(13(12)9-16(15)19)11-4-2-1-3-5-11;/h1-5,8-9,14,18-19H,6-7,10H2;1H/t14-;/m0./s1 | | InChIKey | KTHOTRUZLPTFOY-UQKRIMTDSA-N | | SMILES | Cl.Oc1cc2[C@@H](CNCCc2cc1Cl)c3ccccc3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | S(-)-SCH-23388 nor methyl- HCl Usage And Synthesis |
| Uses | Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| | S(-)-SCH-23388 nor methyl- HCl Preparation Products And Raw materials |
|