| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Methyl 4-(acetylamino)-2-methoxy-5-nitr& Basic information |
| Product Name: | Methyl 4-(acetylamino)-2-methoxy-5-nitr& | | Synonyms: | methyl 4-(acetylamino)-5-nitro-o-anisate;4-Acetamido-2-methoxy-5-nitrobenzoic acid methylester;METHYL 4-(ACETYLAMINO)-2-METHOXY-5-NITRO;5-NITROMETHOPABATE;4-Acetylamino-2-methoxy-5-nitro-benzoic acid methyl ester;Methyl 4-(acetylamino)-2-methoxy-5-nitrobenzoate;methyl 4-acetamido-2-methoxy-5-nitrobenzoate;methyl 4-acetamido-2-methoxy-5-nitro-benzoate | | CAS: | 4093-41-8 | | MF: | C11H12N2O6 | | MW: | 268.22 | | EINECS: | 223-844-3 | | Product Categories: | C10 to C11;Carbonyl Compounds;Esters;Benzene series | | Mol File: | 4093-41-8.mol |  |
| | Methyl 4-(acetylamino)-2-methoxy-5-nitr& Chemical Properties |
| Melting point | 171-173 °C (lit.) | | Boiling point | 506.8±50.0 °C(Predicted) | | density | 1.366±0.06 g/cm3(Predicted) | | pka | 12.80±0.70(Predicted) | | InChI | 1S/C11H12N2O6/c1-6(14)12-8-5-10(18-2)7(11(15)19-3)4-9(8)13(16)17/h4-5H,1-3H3,(H,12,14) | | InChIKey | AGSSDWHUSPSVFS-UHFFFAOYSA-N | | SMILES | COC(=O)c1cc(c(NC(C)=O)cc1OC)[N+]([O-])=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Methyl 4-(acetylamino)-2-methoxy-5-nitr& Usage And Synthesis |
| | Methyl 4-(acetylamino)-2-methoxy-5-nitr& Preparation Products And Raw materials |
|