| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Nitro-3-(trifluoromethyl)benzoic acid& Basic information |
| | 4-Nitro-3-(trifluoromethyl)benzoic acid& Chemical Properties |
| Melting point | 160-164 °C (lit.) | | Boiling point | 348.6±42.0 °C(Predicted) | | density | 1.596±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 2.99±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | 1S/C8H4F3NO4/c9-8(10,11)5-3-4(7(13)14)1-2-6(5)12(15)16/h1-3H,(H,13,14) | | InChIKey | JIQCKYQIVYCTEZ-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(c(c1)C(F)(F)F)[N+]([O-])=O |
| Hazard Codes | Xn | | Risk Statements | 22-36-43 | | Safety Statements | 26-36/37 | | WGK Germany | 2 | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |
| | 4-Nitro-3-(trifluoromethyl)benzoic acid& Usage And Synthesis |
| | 4-Nitro-3-(trifluoromethyl)benzoic acid& Preparation Products And Raw materials |
|