| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Amino-3-(Trifluoromethyl)Benzoic Acid 3-Trifluoromethyl-4-Aminobenzoic Acid Basic information |
| | 4-Amino-3-(Trifluoromethyl)Benzoic Acid 3-Trifluoromethyl-4-Aminobenzoic Acid Chemical Properties |
| Melting point | 204-206°C | | Boiling point | 319.1±42.0 °C(Predicted) | | density | 1.489 | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO, Methaniol | | pka | 4.43±0.10(Predicted) | | form | Solid | | color | Off-White to Pale Yellow | | Sensitive | Air Sensitive | | InChI | InChI=1S/C8H6F3NO2/c9-8(10,11)5-3-4(7(13)14)1-2-6(5)12/h1-3H,12H2,(H,13,14) | | InChIKey | NPPPORJZPNJXNQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(N)C(C(F)(F)F)=C1 |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2922290090 |
| | 4-Amino-3-(Trifluoromethyl)Benzoic Acid 3-Trifluoromethyl-4-Aminobenzoic Acid Usage And Synthesis |
| Chemical Properties | White Solid | | Synthesis | General procedure for the synthesis of 3-trifluoromethyl-4-aminobenzoic acid from 4-nitro-3-(trifluoromethyl)benzoic acid: 4-nitro-3-(trifluoromethyl)benzoic acid (1 g, 4.25 mmol) was dissolved in methanol at room temperature, 10% Pd/C catalyst was added, and the hydrogenation reaction was carried out overnight under hydrogen atmosphere (balloon pressure). Upon completion of the reaction, the catalyst was removed by filtration and the solvent was evaporated to give the colorless solid product 3-trifluoromethyl-4-aminobenzoic acid (870 mg, quantitative yield). | | References | [1] Patent: WO2010/132615, 2010, A1. Location in patent: Page/Page column 119
[2] Journal of the American Chemical Society, 1951, vol. 73, p. 5125 |
| | 4-Amino-3-(Trifluoromethyl)Benzoic Acid 3-Trifluoromethyl-4-Aminobenzoic Acid Preparation Products And Raw materials |
|