- 4-chlorophthalimide
-
-
2026-09-16
- CAS:7147-90-2
- Min. Order: 25kgs/paper bag
- Purity: 98%
- Supply Ability: 10 tons
- 4-Chlorophthalimide
-
- $58.60
-
2026-09-15
- CAS:7147-90-2
- Min. Order: 25Kg/Drum
- Purity: 99.00%HPLC
- Supply Ability: 18tons/month
|
| | 4-Chlorophthalimide Basic information | | Uses |
| Product Name: | 4-Chlorophthalimide | | Synonyms: | 4-CHLOROPHTHALIMIDE;5-chloroisoindole-1,3-dione;5-chloro-2,3-dihydro-1H-isoindole-1,3-dione;P-CHLOROPHTHALIMIDE;Nsc27008;1H-Isoindole-1,3(2H)-dione, 5-chloro- | | CAS: | 7147-90-2 | | MF: | C8H4ClNO2 | | MW: | 181.58 | | EINECS: | 1312995-182-4 | | Product Categories: | | | Mol File: | 7147-90-2.mol |  |
| | 4-Chlorophthalimide Chemical Properties |
| Melting point | 210 °C | | density | 1.519±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 9.08±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H4ClNO2/c9-4-1-2-5-6(3-4)8(12)10-7(5)11/h1-3H,(H,10,11,12) | | InChIKey | BGJNRQSGJHVURK-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C(Cl)C=C2)C(=O)N1 | | CAS DataBase Reference | 7147-90-2(CAS DataBase Reference) |
| | 4-Chlorophthalimide Usage And Synthesis |
| Uses | 5-Chloroisoindoline-1,3-dione is a useful research chemical. | | Chemical Properties | slight yellow crystalline powder | | Synthesis | 0.01g of MnO2 catalyst, 0.5mmol of 1-indanone, 0.2g of ammonia water and 2g of chlorobenzene were added to a stainless steel autoclave with a polytetrafluoroethylene inner liner. The temperature was raised to 110 by automatic temperature controller, 0.6MPa oxygen was added and the reaction was continued for 4h. The pressure was kept constant during the reaction. The reaction product was analyzed using GC-MS with a 4-Chlorophthalimide yield of 85 %.
 | | References | [1] Patent: CN106278990, 2017, A. Location in patent: Paragraph 0013; 0017; 0018; 0020; 0024; 0028 |
| | 4-Chlorophthalimide Preparation Products And Raw materials |
|