| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N-Cbz-4-hydroxycyclohexane Basic information |
| | N-Cbz-4-hydroxycyclohexane Chemical Properties |
| Melting point | 161-165 °C | | form | solid | | InChI | 1S/C14H19NO3/c16-13-8-6-12(7-9-13)15-14(17)18-10-11-4-2-1-3-5-11/h1-5,12-13,16H,6-10H2,(H,15,17) | | InChIKey | JNPBKQOVSMBPGE-UHFFFAOYSA-N | | SMILES | OC1CCC(CC1)NC(=O)OCc2ccccc2 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | N-Cbz-4-hydroxycyclohexane Usage And Synthesis |
| | N-Cbz-4-hydroxycyclohexane Preparation Products And Raw materials |
|