|
|
| | Triphenylsulfonium hexafluorophosphate Basic information |
| Product Name: | Triphenylsulfonium hexafluorophosphate | | Synonyms: | triphenylsulphonium hexafluorophosphate(1-);Sulfonium, triphenyl-, hexafluorophosphate;Sulfonium,triphenyl-,hexafluorophosphate;triphenyl-sulfoniu hexafluorophosphate;Sulfonium,triphenyl-,hexafluorophosphate(1-);triphenyl-sulfoniuhexafluorophosphate(1-);Triphenylsulfoniumhexfluorophosphate;Triphenylsulfonium hexafluorophosphate(V) | | CAS: | 57835-99-1 | | MF: | C18H15F6PS | | MW: | 408.34 | | EINECS: | 260-978-1 | | Product Categories: | | | Mol File: | 57835-99-1.mol |  |
| | Triphenylsulfonium hexafluorophosphate Chemical Properties |
| storage temp. | Store at 0-8 °C | | InChI | InChI=1S/C18H15S.F6P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-1 | | InChIKey | OFOZWFGJJSDVIP-UHFFFAOYSA-N | | SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].[S+](C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1 | | EPA Substance Registry System | Sulfonium, triphenyl-, hexafluorophosphate(1-) (57835-99-1) |
| | Triphenylsulfonium hexafluorophosphate Usage And Synthesis |
| Uses | TRIPHENYLSULFONIUM HEXAFLUOROPHOSPHATE is mainly used as a photopolymerization initiator. |
| | Triphenylsulfonium hexafluorophosphate Preparation Products And Raw materials |
|