|
|
| | Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate Basic information |
| Product Name: | Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate | | Synonyms: | Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate;sulfonium diphenyl[(phenylthio)phenyl] hexafluorophosphate;Sulphonium diphenyl[(phenylthio)phenyl]hexafluorophosphate;Mixed of Triaryl-sulfonium Hexafluoro- Phosphate Salt;HRcure-6992;Thiophenoxyphenyl)diphenylsulfonium hexafluorophosphate;JADEADD PI-001;PAG-101 | | CAS: | 75482-18-7 | | MF: | C24H19S2.F6P | | MW: | 516.5 | | EINECS: | 1308068-626-2 | | Product Categories: | | | Mol File: | 75482-18-7.mol | ![Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate Structure](CAS/GIF/75482-18-7.gif) |
| | Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate Chemical Properties |
| Melting point | 112-114 °C(Solv: methanol (67-56-1)) | | InChI | InChI=1S/C24H19S2.F6P/c1-4-10-20(11-5-1)25-21-16-18-24(19-17-21)26(22-12-6-2-7-13-22)23-14-8-3-9-15-23;1-7(2,3,4,5)6/h1-19H;/q+1;-1 | | InChIKey | MUVYOKJVJZFJTI-UHFFFAOYSA-N | | SMILES | [S+](C1=CC=CC=C1)(C1C=CC=CC=1)C1=CC=C(C=C1)SC1=CC=CC=C1.[P-](F)(F)(F)(F)(F)F |
| | Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate Usage And Synthesis |
| Uses | Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate (SON) can serve as a cationic photoinitiator in two-component photoinitiating systems with diphenyl sulfone-based dyes (DSOs). These systems are utilized to initiate the cationic polymerization of epoxides (like E51) under a 405 nm LED light source[1]. | | References | [1] Xiaoqin Jia . (2019). Diphenyl sulfone-based A–π-D–π-A dyes as efficient initiators for one-photon and two-photon initiated polymerization1. Polymer Chemistry, 10 17, Pages 2152-2161. https://doi.org/10.1039/C8PY01778F
|
| | Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate Preparation Products And Raw materials |
|