| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | BOC-BETA-CYCLOHEXYL-L-ALANINOL Basic information |
| | BOC-BETA-CYCLOHEXYL-L-ALANINOL Chemical Properties |
| Boiling point | 214 °C(lit.) | | density | 1.126 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.464(lit.) | | Fp | 137 °F | | storage temp. | -15°C | | form | liquid | | pka | 12.076±0.46(predicted) | | Appearance | Colorless to light yellow Viscous liquid | | Optical Rotation | [α]20/D 25°, c = 1 in ethanol | | InChI | 1S/C14H27NO3/c1-14(2,3)18-13(17)15-12(10-16)9-11-7-5-4-6-8-11/h11-12,16H,4-10H2,1-3H3,(H,15,17)/t12-/m0/s1 | | InChIKey | BOJQBBXPSVGTQT-LBPRGKRZSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](CO)CC1CCCCC1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | BOC-BETA-CYCLOHEXYL-L-ALANINOL Usage And Synthesis |
| Uses | Precursor to (S)-N-t-Boc-cyclohexylalaninal. This precursor was oxidized to the corresponding α-amino aldehyde in good yield and high optical purity. |
| | BOC-BETA-CYCLOHEXYL-L-ALANINOL Preparation Products And Raw materials |
|