| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Bis(cyclopentadienyl)ruthenium Basic information |
| | Bis(cyclopentadienyl)ruthenium Chemical Properties |
| Melting point | 199-201 °C(lit.) | | Boiling point | 275.9°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystal | | color | light yellow | | Sensitive | Air & Moisture Sensitive | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | InChI=1S/2C5H5.Ru/c2*1-2-4-5-3-1;/h2*1-5H; | | InChIKey | BKEJVRMLCVMJLG-UHFFFAOYSA-N | | SMILES | [CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Ru] |^1:0,1,2,3,4,5,6,7,8,9| | | CAS DataBase Reference | 1287-13-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Bis(cyclopentadienyl)ruthenium Usage And Synthesis |
| Chemical Properties | white to light brown crystals or | | Uses | Intermediate for high-temperature compounds
and for UV radiation absorbers in paints. | | reaction suitability | core: ruthenium reagent type: catalyst | | Purification Methods | Sublime it in high vacuum at 120o. It forms yellow crystals which can be recrystallised from CCl4 as transparent plates. [Wilkinson J Am Chem Soc 74 6146 1952, Beilstein 16 IV 1833.] |
| | Bis(cyclopentadienyl)ruthenium Preparation Products And Raw materials |
|