| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Benzyl tert-butyl malonate Basic information |
| Product Name: | Benzyl tert-butyl malonate | | Synonyms: | MALONIC ACID BENZYL TERT-BUTYL ESTER;MALONIC ACID TERT-BUTYL BENZYL ESTER;MALONIC ACID BENZYL ESTER TERT-BUTYL ESTER;RARECHEM AH CK 0121;Malonic acid benzyl tert-butyl ester 95%;BENZYL TERT-BUTYL MA;Benzyl tert-butyl malonate 95%;Benzyl tert-butyl propane-1,3-dioate | | CAS: | 72594-86-6 | | MF: | C14H18O4 | | MW: | 250.29 | | EINECS: | 639-332-1 | | Product Categories: | Aromatic Esters | | Mol File: | 72594-86-6.mol |  |
| | Benzyl tert-butyl malonate Chemical Properties |
| Boiling point | 312.1±17.0 °C(Predicted) | | density | 1.096±0.06 g/cm3(Predicted) | | refractive index | 1.4860 | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | pka | 11.76±0.46(Predicted) | | color | Clear, colourless | | Water Solubility | Not miscible or difficult to mix in water. | | BRN | 5434466 | | InChI | InChI=1S/C14H18O4/c1-14(2,3)18-13(16)9-12(15)17-10-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3 | | InChIKey | XKXXXODAXXAFNP-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)CC(OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 72594-86-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | Hazard Note | Irritant | | HS Code | 2915390090 |
| Provider | Language |
|
ALFA
| English |
| | Benzyl tert-butyl malonate Usage And Synthesis |
| Uses | Benzyl tert-butyl malonate is used as a pharmaceutical intermediate. |
| | Benzyl tert-butyl malonate Preparation Products And Raw materials |
|