|
|
| | 3,3-Dimethylcyclohexanone Basic information |
| Product Name: | 3,3-Dimethylcyclohexanone | | Synonyms: | 3,3-DIMETHYLCYCLOHEXANONE;3,3-dimethylcyclohexanoe;3,3-Dimethylcyclohexane-1-one;3,3-dimethylcyclohexan-1-one;3,3-DiMethylcyclohexanone 90%;Cyclohexanone, 3,3-dimethyl-;3,3-Dimethylcyclohexanone>;3,3-Dimethyl Cyclohexanone (DMCH) | | CAS: | 2979-19-3 | | MF: | C8H14O | | MW: | 126.2 | | EINECS: | 628-905-1 | | Product Categories: | C7 to C8;Carbonyl Compounds;Ketones | | Mol File: | 2979-19-3.mol |  |
| | 3,3-Dimethylcyclohexanone Chemical Properties |
| Melting point | 9.25°C (estimate) | | Boiling point | 174-175 °C (lit.) | | density | 0.909 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.449(lit.) | | Fp | 175°C | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C8H14O/c1-8(2)5-3-4-7(9)6-8/h3-6H2,1-2H3 | | InChIKey | ZVJQBBYAVPAFLX-UHFFFAOYSA-N | | SMILES | C1(=O)CCCC(C)(C)C1 | | EPA Substance Registry System | Cyclohexanone, 3,3-dimethyl- (2979-19-3) |
| Hazard Codes | Xi | | Risk Statements | 41-36-10 | | Safety Statements | 26-38 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 3 | | HazardClass | IRRITANT | | PackingGroup | III | | HS Code | 29142990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1
Flam. Liq. 3 |
| | 3,3-Dimethylcyclohexanone Usage And Synthesis |
| Uses | An interest in the boll weevil sex attractants prompted an investigation into alternative syntheses of the starting material, 3, 3-dimethylcyclohexanone. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 40, p. 3619, 1975 DOI: 10.1021/jo00912a040 |
| | 3,3-Dimethylcyclohexanone Preparation Products And Raw materials |
| Raw materials | 4 4-DIMETHYLCYCLOHEXANONE 97-->1,1-DIMETHYLCYCLOHEXANE-->3,3-dimethylcyclohexan-1-ol-->2,2-DIMETHYLCYCLOHEXANONE | | Preparation Products | 1-((4'-chloro-5,5-dimethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-yl)methyl)piperazine-->3,3-dimethylcyclohexanemethanol-->Cyclohexane, 1,1-difluoro-3,3-dimethyl--->3,3-Dimethyl-cyclohexylamine |
|