|
|
| | 4-Phenylcyclohexanone Basic information |
| | 4-Phenylcyclohexanone Chemical Properties |
| Melting point | 73-77 °C (lit.) | | Boiling point | 158-160°C 16mm | | density | 0.97 g/cm3 (25℃) | | refractive index | 1.5363 (estimate) | | Fp | 100°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, Methanol | | form | Crystalline Powder | | color | White to off-white | | Water Solubility | slightly soluble | | BRN | 2045904 | | InChI | InChI=1S/C12H14O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-5,11H,6-9H2 | | InChIKey | YKAYMASDSHFOGI-UHFFFAOYSA-N | | SMILES | C1(=O)CCC(C2=CC=CC=C2)CC1 | | CAS DataBase Reference | 4894-75-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29143900 | | Storage Class | 11 - Combustible Solids |
| | 4-Phenylcyclohexanone Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder | | Uses | 4-Phenylcyclohexanone is used in the synthesis of CCR2 antagonists for the treatment of rheumatoid arthritis, atherosclerosis and other disease states. Also used in the preparation of coumarins via dehydrogenation and Heck coupling reactions. | | Uses | 4-Phenylcyclohexanone was used in the preparation of new cardo diamine monomer, 1,1-bis[4-(4-aminophenoxy)phenyl]-4-phenylcyclohexane bearing a 4-phenylcyclohexylidene unit. | | General Description | 4-Phenylcyclohexanone undergoes Ruthenium-catalyzed reaction with tributylamine to yield 2-butyl-4-phenylcyclohexanone and 2,6-dibutyl-4-phenylcyclohexanone. Wittig reaction of 4-phenylcyclohexanone with (carbethoxymethylene)triphenylphosphorane under microwave irradiation has been investigated. |
| | 4-Phenylcyclohexanone Preparation Products And Raw materials |
|