|
|
| | cis-3-Hexenyl salicylate Basic information |
| | cis-3-Hexenyl salicylate Chemical Properties |
| Boiling point | 271 °C(lit.) | | density | 1.059 g/mL at 25 °C(lit.) | | vapor pressure | 0.15Pa at 25℃ | | refractive index | n20/D 1.521(lit.) | | FEMA | 4750 | CIS-3-HEXENYL SALICYLATE | | Fp | >230 °F | | storage temp. | 2-8°C, stored under nitrogen | | solubility | Chloroform (Sparingly), Methanol (Sparingly) | | form | Oil | | pka | 8.12±0.30(Predicted) | | Specific Gravity | 1.059 | | color | Colourless | | Odor | at 100.00 %. floral green metallic herbal balsam | | Odor Type | floral | | biological source | synthetic | | Water Solubility | 5mg/L at 20℃ | | JECFA Number | 2275 | | Stability: | Light Sensitive | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C13H16O3/c1-2-3-4-7-10-16-13(15)11-8-5-6-9-12(11)14/h3-6,8-9,14H,2,7,10H2,1H3/b4-3- | | InChIKey | IEPWIPZLLIOZLU-ARJAWSKDSA-N | | SMILES | [H]\C(CC)=C(/[H])CCOC(=O)c1ccccc1O | | LogP | 4.8 at 25℃ | | CAS DataBase Reference | 65405-77-8(CAS DataBase Reference) | | NIST Chemistry Reference | Cis-3-hexenyl salicylate(65405-77-8) | | EPA Substance Registry System | Benzoic acid, 2-hydroxy-, (3Z)-3-hexenyl ester (65405-77-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | VO3500000 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | cis-3-Hexenyl salicylate Usage And Synthesis |
| Chemical Properties | (Z)-3-Hexenyl salicyla has been identified
in carnation flower absolute. It is a colorless liquid with a long-lasting,
sweet, green balsamic odor. | | Uses | flavors and fragrances | | Definition | ChEBI: Cis-3-Hexenyl salicylate is a benzoate ester. | | Preparation | from cis-3-Hexenol and Salicylic
acid by azeotropic type estcrification. | | Flammability and Explosibility | Non flammable |
| | cis-3-Hexenyl salicylate Preparation Products And Raw materials |
|