|
|
| | Ethylene-d4 DiaMine Basic information |
| Product Name: | Ethylene-d4 DiaMine | | Synonyms: | ETHYLENE-D4-DIAMINE;ETHYLENE-D4-DIAMINE, 98 ATOM % D;1,2-Ethane-1,1,2,2-d4-diamine;1,1,2,2-tetradeuterioethane-1,2-diamine;Ethylene-d?-diamine;Ethylene-d4-diamine;Ethylenediamine (D?, 98%);1,2-Ethane-1,1,2,2-d4-diamine(9CI) | | CAS: | 37164-19-5 | | MF: | C2H8N2 | | MW: | 60.1 | | EINECS: | | | Product Categories: | Alphabetical Listings;E-F;Stable Isotopes;Amines, Isotope Labelled Compounds, Miscellaneous Reagents, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 37164-19-5.mol |  |
| | Ethylene-d4 DiaMine Chemical Properties |
| Melting point | 9 °C(lit.) | | Boiling point | 118 °C(lit.) | | density | 1.022 g/mL at 25 °C | | refractive index | n20/D 1.455(lit.) | | Fp | 93 °F | | solubility | soluble in Chloroform, Methanol | | form | Oil | | color | Clear Colourless to Pale Yellow | | InChI | 1S/C2H8N2/c3-1-2-4/h1-4H2/i1D2,2D2 | | InChIKey | PIICEJLVQHRZGT-LNLMKGTHSA-N | | SMILES | [2H]C([2H])(N)C([2H])([2H])N | | CAS Number Unlabeled | 107-15-3 |
| Hazard Codes | C | | Risk Statements | 10-21/22-34-42/43 | | Safety Statements | 23-26-36/37/39-45 | | RIDADR | UN 1604 8/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 3 Eye Dam. 1 Flam. Liq. 3 Resp. Sens. 1B Skin Corr. 1B Skin Sens. 1B |
| | Ethylene-d4 DiaMine Usage And Synthesis |
| Uses | Isotope labelled Ethylene Diamine(Ethylene-d4 Diamine), a chemical reagent used in the production of various derivatives containing varying functional groups. It is also a known chelating agent. It has also been seen to reduce seizures caused by systematic injection of proconvulsants. It displays antiepileptic and anxiolytic activity. |
| | Ethylene-d4 DiaMine Preparation Products And Raw materials |
|