|
|
| | BOC-L-3-Trifluoromethylphe Basic information |
| | BOC-L-3-Trifluoromethylphe Chemical Properties |
| Melting point | 135-138 °C | | Boiling point | 423.2±45.0 °C(Predicted) | | density | 1.271±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.79±0.10(Predicted) | | form | Solid | | Optical Rotation | [α]20/D +7.3±0.5°, c = 1% in methanol | | BRN | 7048145 | | Major Application | peptide synthesis | | InChI | 1S/C15H18F3NO4/c1-14(2,3)23-13(22)19-11(12(20)21)8-9-5-4-6-10(7-9)15(16,17)18/h4-7,11H,8H2,1-3H3,(H,19,22)(H,20,21)/t11-/m0/s1 | | InChIKey | SHMWDGGGZHFFRC-NSHDSACASA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cccc(c1)C(F)(F)F)C(O)=O | | CAS DataBase Reference | 142995-31-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | Hazard Note | Harmful/Irritant/Keep Cold | | HazardClass | IRRITANT | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | BOC-L-3-Trifluoromethylphe Usage And Synthesis |
| Uses | Boc-L-3-Trifluoromethylphenylalanine (Boc-Phe(3-CF3)-OH) is a phenylalanine derivative that can be used in peptide synthesis. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-L-3-Trifluoromethylphe Preparation Products And Raw materials |
|