3,4-DIMETHYLCYCLOHEXANOL manufacturers
|
| | 3,4-DIMETHYLCYCLOHEXANOL Basic information |
| Product Name: | 3,4-DIMETHYLCYCLOHEXANOL | | Synonyms: | 3,4-DIMETHYLCYCLOHEXANOL;Cyclohexanol, 3,4-dimethyl-;HEXAHYDRO-O-4-XYLENOL;3,4-dimethylcyclohexan-1-ol;1-HYDROXY-3,4-DIMETHYLCYCLOHEXANE;3,4-DIMETHYLCYCLOHEXANOL (MIXTURE OF ISOMERS);3,4-DIMETHYLCYCLOHEXANOL 97%;1-HYDROXY-3,4-DIMETHYLCYCLOHEXANE 97% | | CAS: | 5715-23-1 | | MF: | C8H16O | | MW: | 128.21 | | EINECS: | 227-211-2 | | Product Categories: | | | Mol File: | 5715-23-1.mol |  |
| | 3,4-DIMETHYLCYCLOHEXANOL Chemical Properties |
| Melting point | 19.68°C (estimate) | | Boiling point | 190-193°C | | density | 0,92 g/cm3 | | refractive index | 1.4630-1.4660 | | Fp | 78°C | | storage temp. | Store at room temperature | | pka | 15.33±0.60(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.92 | | InChI | InChI=1S/C8H16O/c1-6-3-4-8(9)5-7(6)2/h6-9H,3-5H2,1-2H3 | | InChIKey | ZBAXJUPCYVIBSP-UHFFFAOYSA-N | | SMILES | C1(O)CCC(C)C(C)C1 |
| Safety Statements | 23-24/25 | | HS Code | 2906190090 |
| Provider | Language |
|
ALFA
| English |
| | 3,4-DIMETHYLCYCLOHEXANOL Usage And Synthesis |
| Description | 3,4-Dimethylcyclohexanol belongs to a class of cyclohexanol compounds.3,4-Dimethylcyclohexanol is a very weakly basic (essentially neutral) compound. This compound is hazardous to humans when exposed for prolonged periods of time and may cause acute solvent syndrome and adverse reactions secondary to hepatotoxicity. | | Definition | ChEBI: 3,4-Dimethylcyclohexanol is a member of cyclohexanols. |
| | 3,4-DIMETHYLCYCLOHEXANOL Preparation Products And Raw materials |
| Raw materials | cis-1,2-dimethylcyclohexanol-->trans-1,2-dimethyl cyclohexanol-->3-Cyclohexene-1-carboxaldehyde, 2-methyl--->Cyclohexene, 3,4-dimethyl--->3,4-DIMETHYLCYCLOHEXANONE-->CIS-1,2-DIMETHYLCYCLOHEXANE-->2,3-dimethylcyclohexan-1-one-->TRANS-1,2-DIMETHYLCYCLOHEXANE-->2,3-DIMETHYLCYCLOHEXANOL |
|