- Tetrahydro-3-furoic Acid
-
- $0.00 / 1KG
-
2026-04-29
- CAS:89364-31-8
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
|
| | TETRAHYDRO-3-FUROIC ACID Basic information |
| | TETRAHYDRO-3-FUROIC ACID Chemical Properties |
| Melting point | 129-130 °C | | Boiling point | 140 °C15 mm Hg(lit.) | | density | 1.214 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4605(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Acetone, Chloroform (Slightly) | | pka | 4.33±0.20(Predicted) | | form | Liquid | | color | Colorless to pale yellow | | InChI | InChI=1S/C5H8O3/c6-5(7)4-1-2-8-3-4/h4H,1-3H2,(H,6,7) | | InChIKey | BOTREHHXSQGWTR-UHFFFAOYSA-N | | SMILES | O1CCC(C(O)=O)C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2932190090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | TETRAHYDRO-3-FUROIC ACID Usage And Synthesis |
| Uses | Tetrahydro-3-furoic Acid can be used in the synthesis of anti-tumor compounds comprising of hydroxyisovalerylshikonin analogs. Furthermore, the compound is a reagent in the synthesis of class II c-Met inhibitors, in the treatment of c-Met dependant tumors. | | Uses | Tetrahydro-3-furoic acid was used in synthesis of o-ethylphenyl tetrahydro-3-furanyl ketone. |
| | TETRAHYDRO-3-FUROIC ACID Preparation Products And Raw materials |
|