|
|
| | Tetrahydro-2H-pyran-4-carboxylic acid Basic information |
| | Tetrahydro-2H-pyran-4-carboxylic acid Chemical Properties |
| Melting point | 87 °C | | Boiling point | 114-146°C 11mm | | density | 1.1066 (rough estimate) | | refractive index | 1.4315 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Solid | | pka | 4.43±0.20(Predicted) | | color | White to off-white | | InChI | InChI=1S/C6H10O3/c7-6(8)5-1-3-9-4-2-5/h5H,1-4H2,(H,7,8) | | InChIKey | AVPKHOTUOHDTLW-UHFFFAOYSA-N | | SMILES | C1OCCC(C(O)=O)C1 | | CAS DataBase Reference | 5337-03-1(CAS DataBase Reference) |
| | Tetrahydro-2H-pyran-4-carboxylic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | Tetrahydropyran-4-yl-carboxylic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| | Tetrahydro-2H-pyran-4-carboxylic acid Preparation Products And Raw materials |
|