|
|
| | 2,2,5,7,8-PENTAMETHYLCHROMAN-6-SULFONYL CHLORIDE Basic information |
| Product Name: | 2,2,5,7,8-PENTAMETHYLCHROMAN-6-SULFONYL CHLORIDE | | Synonyms: | PMC-CHLORIDE;PMC-CL;2,2,5,7,8-PENTAMETHYLCHROMANE-6-SULFONYL;2,2,5,7,8-PENTAMETHYLCHROMAN-6-SULFONYL CHLORIDE;2,2,5,7 8-PENTAMETHYLCHROMAN-6-SULPHONYL CHLORIDE;2,2,5,7,8-PENTAMETHYL-CHROMANE-6-SULFONYL CHLORIDE;3,4-dihydro-2,2,5,7,8-pentamethyl-2h-1-benzopyran-6-sulfonyl chloride;2,2,5,7,8-pentamethyl-6-chromansulfonyl chloride | | CAS: | 112160-39-1 | | MF: | C14H19ClO3S | | MW: | 302.82 | | EINECS: | | | Product Categories: | | | Mol File: | 112160-39-1.mol |  |
| | 2,2,5,7,8-PENTAMETHYLCHROMAN-6-SULFONYL CHLORIDE Chemical Properties |
| Melting point | 77-82 °C | | Boiling point | 410.9±45.0 °C(Predicted) | | density | 1.205±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | powder | | BRN | 4488701 | | Major Application | peptide synthesis | | InChI | 1S/C14H19ClO3S/c1-8-9(2)13(19(15,16)17)10(3)11-6-7-14(4,5)18-12(8)11/h6-7H2,1-5H3 | | InChIKey | UXUOVYKDMGFUDU-UHFFFAOYSA-N | | SMILES | Cc1c(C)c(c(C)c2CCC(C)(C)Oc12)S(Cl)(=O)=O |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2,2,5,7,8-PENTAMETHYLCHROMAN-6-SULFONYL CHLORIDE Usage And Synthesis |
| | 2,2,5,7,8-PENTAMETHYLCHROMAN-6-SULFONYL CHLORIDE Preparation Products And Raw materials |
|