|
|
| | ETH 2120 Basic information |
| Product Name: | ETH 2120 | | Synonyms: | ETH 2120;SODIUM IONOPHORE III;N,N,N',N'-TETRACYCLOHEXYL-1,2-PHENYLENEDIOXYDIACETAMIDE;N,N-Dicyclohexyl-2-(2-[2-(dicyclohexylamino)-2-oxoethoxy]phenoxy)aceta mide;ETH 2120, N,N,Nμ,Nμ-Tetracyclohexyl-1,2-phenylenedioxydiacetamide;ETH 2120(Sodium ionophore III);ETH2120;ETH-2120;Acetamide, 2,2'-[1,2-phenylenebis(oxy)]bis[N,N-dicyclohexyl- | | CAS: | 81686-22-8 | | MF: | C34H52N2O4 | | MW: | 552.79 | | EINECS: | | | Product Categories: | | | Mol File: | 81686-22-8.mol |  |
| | ETH 2120 Chemical Properties |
| Boiling point | 709.4±53.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Chloroform: 10 mg/ml | | form | A crystalline solid | | pka | -0.71±0.20(Predicted) | | color | White to off-white | | InChIKey | GKRBLFCTFPAHMH-UHFFFAOYSA-N | | SMILES | O=C(COc1ccccc1OCC(=O)N(C2CCCCC2)C3CCCCC3)N(C4CCCCC4)C5CCCCC5 |
| Hazard Codes | Xi | | Risk Statements | 37 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | STOT SE 3 |
| | ETH 2120 Usage And Synthesis |
| Uses | N,N-Dicyclohexyl-2-{2-[(dicyclohexylcarbamoyl)methoxy]phenoxy}acetamide an ionophore. |
| | ETH 2120 Preparation Products And Raw materials |
|