|
|
| | 2-(2-Methoxyphenoxy)ethylamine Basic information |
| | 2-(2-Methoxyphenoxy)ethylamine Chemical Properties |
| Boiling point | 98 °C / 0.4mmHg | | density | 1.11 | | vapor pressure | 1.573Pa at 25℃ | | refractive index | 1.5440 to 1.5480 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Difficult to mix. | | pka | 8.55±0.10(Predicted) | | form | Oil | | color | Clear Colourless | | Sensitive | Air Sensitive | | InChI | InChI=1S/C9H13NO2/c1-11-8-4-2-3-5-9(8)12-7-6-10/h2-5H,6-7,10H2,1H3 | | InChIKey | CKJRKLKVCHMWLV-UHFFFAOYSA-N | | SMILES | C(N)COC1=CC=CC=C1OC | | CAS DataBase Reference | 1836-62-0(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | RIDADR | UN2735 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2922190090 |
| Provider | Language |
|
ALFA
| English |
| | 2-(2-Methoxyphenoxy)ethylamine Usage And Synthesis |
| Chemical Properties | Colorless or light yellow liquid | | Uses | 2-(2-Methoxyphenoxy)ethylamine is used for its reaction with 4-(2,3-epoxypropoxy) carbazole for preparation of Carvedilol (I). |
| | 2-(2-Methoxyphenoxy)ethylamine Preparation Products And Raw materials |
|