- HOBthydrate
-
- $2.20
-
2026-08-25
- CAS:80029-43-2
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 100kg
|
| | 1-Hydroxybenzotriazole hydrate Basic information |
| Product Name: | 1-Hydroxybenzotriazole hydrate | | Synonyms: | 1-HYDROXYBENZOTRIAZOLE N-HYDRATE;1-HYDROXYBENZOTRIAZOL MONOHYDRATE;1,2,3-BENZOTRIAZOL-1-OL MONOHYDRATE;1-HYDROXY-1,2,3-BENZOTRIAZOLE (HOBT);HOBt hydrate;1-Hydroxybenzotriazole hydrate;HOBT monohydrate (1 Hydroxybenzotriazole monohydrate);TIMTEC-BB SBB000114 | | CAS: | 80029-43-2 | | MF: | C6H7N3O2 | | MW: | 153.14 | | EINECS: | 806-689-1 | | Product Categories: | | | Mol File: | 80029-43-2.mol |  |
| | 1-Hydroxybenzotriazole hydrate Chemical Properties |
| Melting point | 155-158 °C(lit.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMF: 100 mg/mL, clear | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C6H5N3O.H2O/c10-9-6-4-2-1-3-5(6)7-8-9;/h1-4,10H;1H2 | | InChIKey | PJUPKRYGDFTMTM-UHFFFAOYSA-N | | SMILES | ON1N=NC2C=CC=CC1=2.O | | CAS DataBase Reference | 80029-43-2(CAS DataBase Reference) |
| Hazard Codes | F | | Risk Statements | 5-11 | | Safety Statements | 15-16-35 | | RIDADR | UN 3380 4.1/PG 1 | | WGK Germany | - | | RTECS | DM1288000 | | F | 4.10-8 | | HS Code | 2933.99.9701 | | HazardClass | 4.1 | | PackingGroup | Ⅰ |
| | 1-Hydroxybenzotriazole hydrate Usage And Synthesis |
| Uses | 1-Hydroxybenzotriazole hydrate can be used as a condensation reagent to prepare Poly-γ-glutamic acid methyl ester from a dimer of γ-glutamic acid. Oxadiazoles via cyclo condensation of amidoximes with trifluoroacetic anhydride or benzoic acid derivatives. |
| | 1-Hydroxybenzotriazole hydrate Preparation Products And Raw materials |
|