|
|
| | 1-Hydroxybenzotriazole hydrate Basic information |
| | 1-Hydroxybenzotriazole hydrate Chemical Properties |
| Melting point | 155-158 °C(lit.) | | Boiling point | 248.8°C (rough estimate) | | density | 1.065 g/cm | | refractive index | 1.6910 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMF: 100 mg/mL, clear | | form | Solid | | color | White to Off-White | | Water Solubility | slightly soluble | | BRN | 4515 | | Stability: | Hygroscopic | | Major Application | peptide synthesis | | InChI | InChI=1S/C6H5N3O.H2O/c10-9-6-4-2-1-3-5(6)7-8-9;/h1-4,10H;1H2 | | InChIKey | PJUPKRYGDFTMTM-UHFFFAOYSA-N | | SMILES | ON1N=NC2C=CC=CC1=2.O | | CAS DataBase Reference | 123333-53-9(CAS DataBase Reference) |
| Hazard Codes | F | | Risk Statements | 5-11-R5-R11-44-1 | | Safety Statements | 15-16-35-7/9-33-S7/9-S33-S16-60-37-26 | | RIDADR | UN 3474 (1-HYDROXYBENZOTRIAZOLE
MONOHYDRATE) | | WGK Germany | - | | F | 4.10-8 | | Hazard Note | Highly Flammable | | HazardClass | 4.1 | | PackingGroup | I | | HS Code | 29339980 | | Storage Class | 4.1A - Other explosive hazardous materials | | Hazard Classifications | Aquatic Chronic 3
Desen. Expl. 2
Eye Irrit. 2 |
| | 1-Hydroxybenzotriazole hydrate Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | 1-Hydroxybenzotriazole hydrate can be used as a condensation reagent to prepare:
- Poly-γ-glutamic acid methyl ester from a dimer of γ-glutamic acid.
- Oxadiazoles via cyclo condensation of amidoximes with trifluoroacetic anhydride or benzoic acid derivatives.
| | Uses | A common additive for peptide coupling. | | Uses |
1-Hydroxybenzotriazole hydrate is used as an additive for oligonucleotide couplings and in racemization-free peptide couplings.
| | General Description | 1-Hydroxybenzotriazole is a coupling reagent used to synthesize amides by the condensation reaction between the activated ester/acid and the amino group of protected amino acids. It is also used as a racemization suppressor during peptide synthesis. | | reaction suitability | reaction type: Addition Reactions | | Toxics Screening Level | The ITSL 1-Hydroxy benzotriazole has been changed from 0.04 μg/m3 to 0.1 μg/m3
based on an annual averaging time. |
| | 1-Hydroxybenzotriazole hydrate Preparation Products And Raw materials |
|