|
|
| | 2-BROMO-6-METHYLPYRAZINE Basic information |
| | 2-BROMO-6-METHYLPYRAZINE Chemical Properties |
| Boiling point | 196℃ | | density | 1.596 | | Fp | 72℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -0.94±0.10(Predicted) | | form | crystals | | color | Clear, colourless to faint pink | | InChI | InChI=1S/C5H5BrN2/c1-4-2-7-3-5(6)8-4/h2-3H,1H3 | | InChIKey | YEFFNSANFKOYSF-UHFFFAOYSA-N | | SMILES | C1(Br)=NC(C)=CN=C1 |
| | 2-BROMO-6-METHYLPYRAZINE Usage And Synthesis |
| Uses | 2-Bromo-6-methylpyrazine is a useful synthetic intermediate. It is used in the synthesis of steroid derivatives as CYP17 inhibitors for the treatment of cancer. |
| | 2-BROMO-6-METHYLPYRAZINE Preparation Products And Raw materials |
|