|
|
| | 1-Cyanocyclobutanecarboxylic acid ethyl ester Basic information |
| Product Name: | 1-Cyanocyclobutanecarboxylic acid ethyl ester | | Synonyms: | ethyl 1-cyanocyclobutanecarboxylate;(Z)-3-hydroxy-1-[5-(thiophen-2-ylmethyl)-2-furanyl]-3-(1H-1,2,4-triazol-5-yl)-2-propen-1-one;Cyclobutanecarboxylic acid, 1-cyano-, ethyl ester;1-Cyano-Cyclobutanecarboxylic Acid Ethyl Este;*Guaiacol Impurity 1 (Guaiacol EP Impurity A)(Pyrocatechol);Ethyl 1-cyanocyclobutane-1-carboxylate;1-Cyanocyclobutanecarboxylic acid ethyl ester | | CAS: | 28246-87-9 | | MF: | C8H11NO2 | | MW: | 153.18 | | EINECS: | | | Product Categories: | | | Mol File: | 28246-87-9.mol |  |
| | 1-Cyanocyclobutanecarboxylic acid ethyl ester Chemical Properties |
| Boiling point | 215.5-216 °C(Press: 762 Torr) | | density | 1.09±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C8H11NO2/c1-2-11-7(10)8(6-9)4-3-5-8/h2-5H2,1H3 | | InChIKey | VPAQDMAYKQBDLT-UHFFFAOYSA-N | | SMILES | C1(C#N)(C(OCC)=O)CCC1 |
| | 1-Cyanocyclobutanecarboxylic acid ethyl ester Usage And Synthesis |
| Uses | 1-CYANOCYCLOBUTANECARBOXYLIC ACID ETHYL ESTER can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical and pharmaceutical production process. | | Synthesis | 
4-(9>-cyclopentyl-5'-methyl-6>-oxo-5>,6>,8>,9>- tetrahydrospiro[cyclobutane-l,7'-pyrimido[4,5-b][l,4]diazepine]-2'-ylamino)-3- methoxybenzoic acid; [0521] Ethyl 1-cyanocyclobutanecarboxylate; To a solution of sodium ethoxide (21wt% in EtOH, 5.79 rnL, 15.5 mmol) in EtOH (25 mL), was added ethyl cyanoacetate(1.12 mL, 10.5 mmol), followed shortly thereafter by 1,1-dibromopropane (1.12 mL, 10 mmol). The reaction mixture was refluxed for 3 hrs. It was then concentrated, and diluted to ethyl acetate. The organic layer was washed with NaHCCh, brine, water, dried over Na2SO4 and concentrated in vacuo to obtain ethyl 1-cyanocyclobutanecarboxylate (1.17 g, 74% yield) as a red liquid. It was used directly for next step reaction. |
| | 1-Cyanocyclobutanecarboxylic acid ethyl ester Preparation Products And Raw materials |
|