| Company Name: |
Hebei Yaocheng Pharmaceutical Technology Co. Ltd
|
| Tel: |
19903117580 19903117510 |
| Email: |
yc-eliu@yaochengph.com |
| Products Intro: |
Product Name:4-(3-Chlorophenyl)-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinane 2-oxide
CAS:883989-27-3
Purity:95% Package:5G;10G;25G;100G;500G;1KG;5KG;25KG
|
|
| | 4-(3-Chlorophenyl)-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinane 2-oxide Basic information |
| Product Name: | 4-(3-Chlorophenyl)-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinane 2-oxide | | Synonyms: | 1,3,2-Dioxaphosphorinane, 4-(3-chlorophenyl)-2-(4-nitrophenoxy)-, 2-oxide;(±)-4-(3-chlorophenyl)-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinane-2-oxide;4-(3-Chlorophenyl)-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinane 2-oxide - [AC78687];4-(3-Chlorophenyl)-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinane 2-oxide | | CAS: | 883989-27-3 | | MF: | C15H13ClNO6P | | MW: | 369.69 | | EINECS: | | | Product Categories: | | | Mol File: | 883989-27-3.mol |  |
| | 4-(3-Chlorophenyl)-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinane 2-oxide Chemical Properties |
| Boiling point | 477.7±45.0 °C(Predicted) | | density | 1.49±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C15H13ClNO6P/c16-12-3-1-2-11(10-12)15-8-9-21-24(20,23-15)22-14-6-4-13(5-7-14)17(18)19/h1-7,10,15H,8-9H2 | | InChIKey | LTBCYGZGEUORSW-UHFFFAOYSA-N | | SMILES | O1CCC(C2=CC=CC(Cl)=C2)OP1(=O)OC1=CC=C([N+]([O-])=O)C=C1 |
| | 4-(3-Chlorophenyl)-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinane 2-oxide Usage And Synthesis |
| Uses | 4-(3-Chlorophenyl)-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinane 2-oxide is an organic heterocyclic intermediate compound that can be used as a useful prodrug platform for the delivery of amines, amides and phenols. |
| | 4-(3-Chlorophenyl)-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinane 2-oxide Preparation Products And Raw materials |
|