BHQ-2 acid manufacturers
- BHQ-2 acid
-
-
2025-06-07
- CAS:1214891-99-2
- Min. Order: 25mg
- Purity: >99.00%
- Supply Ability: 25mg
|
| | BHQ-2 acid Basic information |
| Product Name: | BHQ-2 acid | | Synonyms: | Butanoic acid, 4-[[4-[2-[2,5-dimethoxy-4-[2-(4-nitrophenyl)diazenyl]phenyl]diazenyl]phenyl]methylamino]-;BHQ-2 acid;QHQ-2;BHQ 2 COOH;HCQ-2 Acid(~BHQ-2 Acid );4-((4-((2,5-Dimethoxy-4-((4-nitrophenyl)diazenyl)phenyl)diazenyl)phenyl)(methyl)amino)butanoic acid;HCQ-2 Acid;4-((4-((E)-(2,5-Dimethoxy-4-((E)-(4-nitrophenyl)diazenyl)phenyl)diazenyl)phenyl)(methyl)amino)butanoic acid | | CAS: | 1214891-99-2 | | MF: | C25H26N6O6 | | MW: | 506.51 | | EINECS: | | | Product Categories: | | | Mol File: | 1214891-99-2.mol |  |
| | BHQ-2 acid Chemical Properties |
| Boiling point | 736.3±60.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | RT, protect from light | | solubility | Easily soluble in DMSO, DMF, methanol, etc. | | pka | 4.67±0.10(Predicted) | | Appearance | Dark purple solid | | ex/em | 566 nm (absorbance peak) | | ε(extinction coefficient) | 38000 L⋅mol−1⋅cm−1 | | InChIKey | UDGUGZTYGWUUSG-TUUFZWAFSA-N | | SMILES | N(/C1C=C(OC)C(/N=N/C2C=CC(N(=O)=O)=CC=2)=CC=1OC)=N\C1C=CC(N(C)CCCC(=O)O)=CC=1 |
| | BHQ-2 acid Usage And Synthesis |
| | BHQ-2 acid Preparation Products And Raw materials |
|