|
|
| | alpha-Phenylcinnamic acid Basic information |
| | alpha-Phenylcinnamic acid Chemical Properties |
| Melting point | 172-174 °C(lit.) | | Boiling point | 325.66°C (rough estimate) | | density | 1.198 | | refractive index | 1.6530 (estimate) | | pka | 4.8 in 60% ethanol | | form | powder to crystal | | color | White to Almost white | | Merck | 14,7281 | | BRN | 1911342 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | 1S/C15H12O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H,16,17)/b14-11+ | | InChIKey | BIDDLDNGQCUOJQ-SDNWHVSQSA-N | | SMILES | OC(=O)\C(=C\c1ccccc1)c2ccccc2 | | CAS DataBase Reference | 91-48-5(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29163990 | | Storage Class | 13 - Non Combustible Solids |
| | alpha-Phenylcinnamic acid Usage And Synthesis |
| Chemical Properties | white to light yellow powder | | Uses | α-Phenylcinnamic Acid, is a 2,3-Diarylpropenoic Acid, which is a selective non-steroidal inhibitors of type-5 17β-hydroxysteroid dehydrogenase (AKR1C3). | | Synthesis Reference(s) | Journal of the American Chemical Society, 104, p. 321, 1982 DOI: 10.1021/ja00365a073 Organic Syntheses, Coll. Vol. 4, p. 777, 1963 | | Purification Methods | Crystallise the cis-isomer from pet ether or EtOH (m 174 |
| | alpha-Phenylcinnamic acid Preparation Products And Raw materials |
|