|
|
| | bis(2-ethylhexyl) cyclohexane-1,2-dicarboxylate Basic information |
| Product Name: | bis(2-ethylhexyl) cyclohexane-1,2-dicarboxylate | | Synonyms: | bis(2-ethylhexyl) cyclohexane-1,2-dicarboxylate;1, 2-Cyclohexanedicarboxylic acid, bis(2-ethylhexyl) ester;Hexahydrophthalic acid bis(2-ethylhexyl) ester;Hexahydrophthalic acid di(2-ethylhexyl) ester;Einecs 201-554-8;1,2-Cyclohexanedicarboxylicacid, 1,2-bis(2-ethylhexyl) ester;Diisooctyl 1,2-cyclohexanedicarboxylate;1,2-BIS(2-ETHYLHEXYL) CYCLOHEXANE-1,2-DICARBOXYLATE | | CAS: | 84-71-9 | | MF: | C24H44O4 | | MW: | 396.6 | | EINECS: | 201-554-8 | | Product Categories: | | | Mol File: | 84-71-9.mol |  |
| | bis(2-ethylhexyl) cyclohexane-1,2-dicarboxylate Chemical Properties |
| Boiling point | 463.9±20.0 °C(Predicted) | | density | 0.959 | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C24H44O4/c1-5-9-13-19(7-3)17-27-23(25)21-15-11-12-16-22(21)24(26)28-18-20(8-4)14-10-6-2/h19-22H,5-18H2,1-4H3 | | InChIKey | DIMOQAGSNHTROK-UHFFFAOYSA-N | | SMILES | C1(C(OCC(CC)CCCC)=O)CCCCC1C(OCC(CC)CCCC)=O | | EPA Substance Registry System | 1,2-Cyclohexanedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester (84-71-9) |
| | bis(2-ethylhexyl) cyclohexane-1,2-dicarboxylate Usage And Synthesis |
| Synthesis Reference(s) | [1] Synthesis and application of an alternative plasticizer Di(2-Ethylhexyl)-1,2-cyclohexane dicarboxylate. J. Appl. Polym. Sci. 2014, 131, 39763. | | Synthesis | Dis(2-ethylhexyl) cyclohexane-1,2-dicarboxylate (DEHCH) was synthesized via esterification between hexahydrophthalic anhydride (HHPA) with iso-octanol by using concentrated sulfuric acid as a catalyst.[1] |
| | bis(2-ethylhexyl) cyclohexane-1,2-dicarboxylate Preparation Products And Raw materials |
|